What are the types of supramolecular chemistry?

• Molecular self-assembly.
• Molecular recognition and complexation.
• Template-directed synthesis.
• Mechanically interlocked molecular architectures.
• Dynamic covalent chemistry.
• Biomimetics.
• Imprinting.
• Molecular machinery.

What are the types of supramolecular interactions?

Supramolecular interactions are a class of interactions categorized by their non-covalent character. Examples of supramolecular interactions include van der Waals forces, pi-pi stacking, hydrogen bonding, metal-ligand coordination, electrostatic interactions, and host-guest interactions.

What are the examples of Supramolecules?

Colloids, liquid crystals, biomolecular condensates, micelles, liposomes and biological membranes are examples of supramolecular assemblies. The dimensions of supramolecular assemblies can range from nanometers to micrometers.

Is supramolecular chemistry organic chemistry?

Supramolecular chemistry, therefore, is a cross discipline of organic chemistry, physical chemistry, coordination chemistry, polymer chemistry, materials science, biological science, and so on.

Who is the father of supramolecular chemistry?

“Father of Supramolecular Chemistry” Jean-Marie Lehn Appointed as an Honorary Professor of Zhejiang University-Archives-Zhejiang University.

What is supramolecular structure?

Supramolecular structures are related to molecules in the same way that molecular structures are related to atoms. Although atoms play a critical role in the paradigms of chemistry, it is molecular structure that is generally at the center of the chemistry of many important technological and biological materials.

What are supramolecular materials?

Supramolecular materials are architectures consisting of molecules that are able to self-assemble into larger constructs (Lehn, 2002). Polymers as well as small molecules are able to form self-assembled structures.

What are supramolecular devices?

Thus a supramolecular device is a complex system. made up of molecular components with definite individual properties. These properties are. intrinsic to a particular molecular component whether it is part of the device or not.

What does Supramolecules mean?

Definition of supramolecular : more complex than a molecule also : composed of many molecules.

Is DNA a supramolecular?

While DNA alone offers a high degree of fidelity in its self-assembly, a new area of research termed ‘supramolecular DNA assembly’ has recently emerged. This field combines DNA building blocks with synthetic organic, inorganic and polymeric structures.

What is supramolecular scale?

Whereas traditional chemistry deals with the construction of individual molecules (1–100 Å length scale) from atoms, supramolecular chemistry deals with the construction of organized molecular “arrays” with much larger length scales (1–100 nm).

What are the basic functions of supramolecular species?

Thus, molecular recognition, transformation and translocation represent the basic functions of supramolecular species.

What is the difference between molecular and supramolecular?

The key difference between supramolecular chemistry and molecular chemistry is that supramolecular chemistry deals with weak, reversible non-covalent interactions between molecules whereas molecular chemistry deals with laws governing the formation and breakage of chemical bonds between molecules.

How supramolecular structures are formed?

Two DNA strands form a helical supramolecular assembly through hydrogen bonding interactions that form between the bases. Thymine can hydrogen bond preferentially with adenine. Cytosine hydrogen bonds preferentially with guanine.

What is supramolecular chemistry PPT?

Supramolecular chemistry, a term introduced by Jean- Marie Lehn, is “chemistry beyond the molecule”, i.e. the chemistry of molecular assemblies using noncovalent bonds.

How do you name Cryptands?

The most common and most important cryptand is N[CH2CH2OCH2CH2OCH2CH2]3N; the systematic IUPAC name for this compound is 1,10-diaza-4,7,13,16,21,24-hexaoxabicyclo[8.8. 8]hexacosane.

What are 3 examples of molecules?

• H2O (water)
• N2 (nitrogen)
• O3 (ozone)
• CaO (calcium oxide)
• C6H12O6 (glucose, a type of sugar)
• NaCl (table salt)

What is size of a molecule?

The approximate distance between the atoms, which takes up most space, is 250 picometers. The sizes of the atoms add up to around 25 picometers. Thus, the size of a molecule of water is approximately 275 picometers. Physics.

Why is supramolecular chemistry important?

Supramolecular chemistry is the subject of the association of two or more chemical species held together by intermolecular forces, such as electrostatic interactions, hydrogen bonding, van der Waals forces, etc., which could lead to organized entities of higher complexity (Lehn, 1985, 1988).

What is supramolecular chemistry PDF?

Supramolecular chemistry has been defined by phrases such as ‘chemistry beyond the molecule’, ‘chemistry of molecular assemblies and of the intermolecular bond’, and ‘non-molecular chemistry’.

What type of bonding exists in Supramolecules?

But in supramolecular chemistry there does not exist a covalent bond, only non covalent interactions such as electrostatic interactions, hydrogen bonding, dispersion interactions and cation-pi interactions present between molecules or ions.

What is meant by supramolecular polymer?

What exactly are supramolecular polymers? They are polymeric arrays of monomer units, held together by reversible and highly directional secondary interactions — that is, non-covalent bonds, such as hydrogen bonds. The resulting materials therefore maintain their polymeric properties in solution.

What are host molecules?

A molecular entity that forms complexes with organic or inorganic guests, or a chemical species that can accommodate guests within cavities of its crystal structure.

What is supramolecular chemistry Mcq?

Supramolecular chemistry is primarily concerned with the intermolecular forces between specific molecules. It is said that molecules are to supramolecules as atoms are to molecules.

What is self-assembly in supramolecular chemistry?

Molecular self-assembly is a process in which molecules (or parts of molecules) spontaneously form ordered aggregates and involves no human intervention; the interactions involved usually are noncovalent. In molecular self-assembly, the molecular structure determines the structure of the assembly (1).